C15H17NO5 — CID 18741174
(2S,3S)-3-[[(2S)-3-methyl-1-oxo-1-phenylbutan-2-yl]carbamoyl]oxirane-2-carboxylic acid (PubChem CID 18741174) has the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. Its IUPAC name is (2S,3S)-3-[[(2S)-3-methyl-1-oxo-1-phenylbutan-2-yl]carbamoyl]oxirane-2-carboxylic acid.
| Compound Name | (2S,3S)-3-[[(2S)-3-methyl-1-oxo-1-phenylbutan-2-yl]carbamoyl]oxirane-2-carboxylic acid |
|---|---|
| PubChem CID | 18741174 |
| Molecular Formula | C15H17NO5 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | (2S,3S)-3-[[(2S)-3-methyl-1-oxo-1-phenylbutan-2-yl]carbamoyl]oxirane-2-carboxylic acid |
| SMILES | CC(C)[C@H](NC(=O)[C@H]1O[C@@H]1C(=O)O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C15H17NO5/c1-8(2)10(11(17)9-6-4-3-5-7-9)16-14(18)12-13(21-12)15(19)20/h3-8,10,12-13H,1-2H3,(H,16,18)(H,19,20)/t10-,12-,13-/m0/s1 |
| InChIKey | QQZRKFIUBRWADZ-DRZSPHRISA-N |
| XLogP | 0.86 |
| TPSA | 96.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|