C15H24FN2O+ — CID 18741378
1-[2-(2-fluoro-4-methylphenoxy)ethyl]-1,4-dimethylpiperazin-1-ium (PubChem CID 18741378) has the molecular formula C15H24FN2O+ and a molecular weight of 267.37 g/mol. Its IUPAC name is 1-[2-(2-fluoro-4-methylphenoxy)ethyl]-1,4-dimethylpiperazin-1-ium.
| Compound Name | 1-[2-(2-fluoro-4-methylphenoxy)ethyl]-1,4-dimethylpiperazin-1-ium |
|---|---|
| PubChem CID | 18741378 |
| Molecular Formula | C15H24FN2O+ |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | 1-[2-(2-fluoro-4-methylphenoxy)ethyl]-1,4-dimethylpiperazin-1-ium |
| SMILES | Cc1ccc(OCC[N+]2(C)CCN(C)CC2)c(F)c1 |
| InChI | InChI=1S/C15H24FN2O/c1-13-4-5-15(14(16)12-13)19-11-10-18(3)8-6-17(2)7-9-18/h4-5,12H,6-11H2,1-3H3/q+1 |
| InChIKey | XMISMBWJFLITCB-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|