About 8-(8-hydroxy-5,5-dimethyloctyl)sulfinyl-4,4-dimethyloctan-1-ol
8-(8-hydroxy-5,5-dimethyloctyl)sulfinyl-4,4-dimethyloctan-1-ol (PubChem CID 18752761) has the molecular formula C20H42O3S
and a molecular weight of 362.62 g/mol. Its IUPAC name is 8-(8-hydroxy-5,5-dimethyloctyl)sulfinyl-4,4-dimethyloctan-1-ol.
Molecular Properties
| Compound Name | 8-(8-hydroxy-5,5-dimethyloctyl)sulfinyl-4,4-dimethyloctan-1-ol |
| PubChem CID | 18752761 |
| Molecular Formula | C20H42O3S |
| Molecular Weight | 362.62 g/mol |
| Exact Mass | 362.29 |
| IUPAC Name | 8-(8-hydroxy-5,5-dimethyloctyl)sulfinyl-4,4-dimethyloctan-1-ol |
| SMILES | CC(C)(CCCO)CCCCS(=O)CCCCC(C)(C)CCCO |
| InChI | InChI=1S/C20H42O3S/c1-19(2,13-9-15-21)11-5-7-17-24(23)18-8-6-12-20(3,4)14-10-16-22/h21-22H,5-18H2,1-4H3 |
| InChIKey | WKOQEHGQRPVWQC-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.62 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-(8-hydroxy-5,5-dimethyloctyl)sulfinyl-4,4-dimethyloctan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(8-hydroxy-5,5-dimethyloctyl)sulfinyl-4,4-dimethyloctan-1-ol?
The IUPAC name of 8-(8-hydroxy-5,5-dimethyloctyl)sulfinyl-4,4-dimethyloctan-1-ol (CID 18752761) is 8-(8-hydroxy-5,5-dimethyloctyl)sulfinyl-4,4-dimethyloctan-1-ol.
What is the SMILES notation for 8-(8-hydroxy-5,5-dimethyloctyl)sulfinyl-4,4-dimethyloctan-1-ol?
The canonical SMILES for 8-(8-hydroxy-5,5-dimethyloctyl)sulfinyl-4,4-dimethyloctan-1-ol is CC(C)(CCCO)CCCCS(=O)CCCCC(C)(C)CCCO.
What is the InChIKey of 8-(8-hydroxy-5,5-dimethyloctyl)sulfinyl-4,4-dimethyloctan-1-ol?
The InChIKey is WKOQEHGQRPVWQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H42O3S/c1-19(2,13-9-15-21)11-5-7-17-24(23)18-8-6-12-20(3,4)14-10-16-22/h21-22H,5-18H2,1-4H3.
What are the key properties of 8-(8-hydroxy-5,5-dimethyloctyl)sulfinyl-4,4-dimethyloctan-1-ol?
8-(8-hydroxy-5,5-dimethyloctyl)sulfinyl-4,4-dimethyloctan-1-ol has a molecular weight of 362.62 g/mol, XLogP of 4.67, 16 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(8-hydroxy-5,5-dimethyloctyl)sulfinyl-4,4-dimethyloctan-1-ol is sourced from PubChem (CID 18752761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).