C16H30N8OS — CID 18752805
5-[2-methyl-6-[5-methyl-5-(2H-tetrazol-5-yl)hexyl]sulfinylhexan-2-yl]-2H-tetrazole (PubChem CID 18752805) has the molecular formula C16H30N8OS and a molecular weight of 382.54 g/mol. Its IUPAC name is 5-[2-methyl-6-[5-methyl-5-(2H-tetrazol-5-yl)hexyl]sulfinylhexan-2-yl]-2H-tetrazole.
| Compound Name | 5-[2-methyl-6-[5-methyl-5-(2H-tetrazol-5-yl)hexyl]sulfinylhexan-2-yl]-2H-tetrazole |
|---|---|
| PubChem CID | 18752805 |
| Molecular Formula | C16H30N8OS |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | 5-[2-methyl-6-[5-methyl-5-(2H-tetrazol-5-yl)hexyl]sulfinylhexan-2-yl]-2H-tetrazole |
| SMILES | CC(C)(CCCCS(=O)CCCCC(C)(C)c1nn[nH]n1)c1nn[nH]n1 |
| InChI | InChI=1S/C16H30N8OS/c1-15(2,13-17-21-22-18-13)9-5-7-11-26(25)12-8-6-10-16(3,4)14-19-23-24-20-14/h5-12H2,1-4H3,(H,17,18,21,22)(H,19,20,23,24) |
| InChIKey | PTVVXNVODCADGG-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 125.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|