C23H27Cl2N4NaO2 — CID 23669744
sodium 2-(3,5-dichlorophenyl)-4-ethyl-5-[6-methyl-6-(2H-tetrazol-5-yl)heptoxy]phenolate (PubChem CID 23669744) has the molecular formula C23H27Cl2N4NaO2 and a molecular weight of 485.39 g/mol. Its IUPAC name is sodium 2-(3,5-dichlorophenyl)-4-ethyl-5-[6-methyl-6-(2H-tetrazol-5-yl)heptoxy]phenolate.
| Compound Name | sodium 2-(3,5-dichlorophenyl)-4-ethyl-5-[6-methyl-6-(2H-tetrazol-5-yl)heptoxy]phenolate |
|---|---|
| PubChem CID | 23669744 |
| Molecular Formula | C23H27Cl2N4NaO2 |
| Molecular Weight | 485.39 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | sodium 2-(3,5-dichlorophenyl)-4-ethyl-5-[6-methyl-6-(2H-tetrazol-5-yl)heptoxy]phenolate |
| SMILES | CCc1cc(-c2cc(Cl)cc(Cl)c2)c([O-])cc1OCCCCCC(C)(C)c1nn[nH]n1.[Na+] |
| InChI | InChI=1S/C23H28Cl2N4O2.Na/c1-4-15-12-19(16-10-17(24)13-18(25)11-16)20(30)14-21(15)31-9-7-5-6-8-23(2,3)22-26-28-29-27-22;/h10-14,30H,4-9H2,1-3H3,(H,26,27,28,29);/q;+1/p-1 |
| InChIKey | VQYSREPCKSCOBP-UHFFFAOYSA-M |
| XLogP | 2.73 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|