C24H32FN4NaO3 — CID 173315511
sodium;4-ethyl-2-[(4-fluorophenyl)methoxy]-5-[6-methyl-6-(2H-tetrazol-5-yl)heptoxy]phenol;hydride (PubChem CID 173315511) has the molecular formula C24H32FN4NaO3 and a molecular weight of 466.53 g/mol. Its IUPAC name is sodium;4-ethyl-2-[(4-fluorophenyl)methoxy]-5-[6-methyl-6-(2H-tetrazol-5-yl)heptoxy]phenol;hydride.
| Compound Name | sodium;4-ethyl-2-[(4-fluorophenyl)methoxy]-5-[6-methyl-6-(2H-tetrazol-5-yl)heptoxy]phenol;hydride |
|---|---|
| PubChem CID | 173315511 |
| Molecular Formula | C24H32FN4NaO3 |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | sodium;4-ethyl-2-[(4-fluorophenyl)methoxy]-5-[6-methyl-6-(2H-tetrazol-5-yl)heptoxy]phenol;hydride |
| SMILES | CCc1cc(OCc2ccc(F)cc2)c(O)cc1OCCCCCC(C)(C)c1nn[nH]n1.[H-].[Na+] |
| InChI | InChI=1S/C24H31FN4O3.Na.H/c1-4-18-14-22(32-16-17-8-10-19(25)11-9-17)20(30)15-21(18)31-13-7-5-6-12-24(2,3)23-26-28-29-27-23;;/h8-11,14-15,30H,4-7,12-13,16H2,1-3H3,(H,26,27,28,29);;/q;+1;-1 |
| InChIKey | XWBQGRSWIVOJEE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 93.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|