C23H28Cl2N4O2 — CID 10206349
2-(3,5-dichlorophenyl)-4-ethyl-5-[6-methyl-6-(2H-tetrazol-5-yl)heptoxy]phenol (PubChem CID 10206349) has the molecular formula C23H28Cl2N4O2 and a molecular weight of 463.41 g/mol. Its IUPAC name is 2-(3,5-dichlorophenyl)-4-ethyl-5-[6-methyl-6-(2H-tetrazol-5-yl)heptoxy]phenol.
| Compound Name | 2-(3,5-dichlorophenyl)-4-ethyl-5-[6-methyl-6-(2H-tetrazol-5-yl)heptoxy]phenol |
|---|---|
| PubChem CID | 10206349 |
| Molecular Formula | C23H28Cl2N4O2 |
| Molecular Weight | 463.41 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | 2-(3,5-dichlorophenyl)-4-ethyl-5-[6-methyl-6-(2H-tetrazol-5-yl)heptoxy]phenol |
| SMILES | CCc1cc(-c2cc(Cl)cc(Cl)c2)c(O)cc1OCCCCCC(C)(C)c1nn[nH]n1 |
| InChI | InChI=1S/C23H28Cl2N4O2/c1-4-15-12-19(16-10-17(24)13-18(25)11-16)20(30)14-21(15)31-9-7-5-6-8-23(2,3)22-26-28-29-27-22/h10-14,30H,4-9H2,1-3H3,(H,26,27,28,29) |
| InChIKey | WHRIUKZKQRPQOZ-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.41 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|