C12H17FN4O — CID 142360325
ethane;5-[(5-ethyl-2-fluorophenoxy)methyl]-2H-tetrazole (PubChem CID 142360325) has the molecular formula C12H17FN4O and a molecular weight of 252.29 g/mol. Its IUPAC name is ethane;5-[(5-ethyl-2-fluorophenoxy)methyl]-2H-tetrazole.
| Compound Name | ethane;5-[(5-ethyl-2-fluorophenoxy)methyl]-2H-tetrazole |
|---|---|
| PubChem CID | 142360325 |
| Molecular Formula | C12H17FN4O |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | ethane;5-[(5-ethyl-2-fluorophenoxy)methyl]-2H-tetrazole |
| SMILES | CC.CCc1ccc(F)c(OCc2nn[nH]n2)c1 |
| InChI | InChI=1S/C10H11FN4O.C2H6/c1-2-7-3-4-8(11)9(5-7)16-6-10-12-14-15-13-10;1-2/h3-5H,2,6H2,1H3,(H,12,13,14,15);1-2H3 |
| InChIKey | WBONYLWXEUBXEL-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |