C15H13ClN4O3S2 — CID 24769732
5-[[4-chloro-2-(4-methylsulfonylphenyl)sulfanylphenoxy]methyl]-2H-tetrazole (PubChem CID 24769732) has the molecular formula C15H13ClN4O3S2 and a molecular weight of 396.88 g/mol. Its IUPAC name is 5-[[4-chloro-2-(4-methylsulfonylphenyl)sulfanylphenoxy]methyl]-2H-tetrazole.
| Compound Name | 5-[[4-chloro-2-(4-methylsulfonylphenyl)sulfanylphenoxy]methyl]-2H-tetrazole |
|---|---|
| PubChem CID | 24769732 |
| Molecular Formula | C15H13ClN4O3S2 |
| Molecular Weight | 396.88 g/mol |
| Exact Mass | 396.01 |
| IUPAC Name | 5-[[4-chloro-2-(4-methylsulfonylphenyl)sulfanylphenoxy]methyl]-2H-tetrazole |
| SMILES | CS(=O)(=O)c1ccc(Sc2cc(Cl)ccc2OCc2nn[nH]n2)cc1 |
| InChI | InChI=1S/C15H13ClN4O3S2/c1-25(21,22)12-5-3-11(4-6-12)24-14-8-10(16)2-7-13(14)23-9-15-17-19-20-18-15/h2-8H,9H2,1H3,(H,17,18,19,20) |
| InChIKey | RSXKAOLCLRNVEJ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.88 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |