C17H15F3NNaO5S2 — CID 141109110
sodium 2-[2-[4-(dimethylsulfamoyl)phenyl]sulfanyl-4-(trifluoromethyl)phenoxy]acetate (PubChem CID 141109110) has the molecular formula C17H15F3NNaO5S2 and a molecular weight of 457.43 g/mol. Its IUPAC name is sodium 2-[2-[4-(dimethylsulfamoyl)phenyl]sulfanyl-4-(trifluoromethyl)phenoxy]acetate.
| Compound Name | sodium 2-[2-[4-(dimethylsulfamoyl)phenyl]sulfanyl-4-(trifluoromethyl)phenoxy]acetate |
|---|---|
| PubChem CID | 141109110 |
| Molecular Formula | C17H15F3NNaO5S2 |
| Molecular Weight | 457.43 g/mol |
| Exact Mass | 457.02 |
| IUPAC Name | sodium 2-[2-[4-(dimethylsulfamoyl)phenyl]sulfanyl-4-(trifluoromethyl)phenoxy]acetate |
| SMILES | CN(C)S(=O)(=O)c1ccc(Sc2cc(C(F)(F)F)ccc2OCC(=O)[O-])cc1.[Na+] |
| InChI | InChI=1S/C17H16F3NO5S2.Na/c1-21(2)28(24,25)13-6-4-12(5-7-13)27-15-9-11(17(18,19)20)3-8-14(15)26-10-16(22)23;/h3-9H,10H2,1-2H3,(H,22,23);/q;+1/p-1 |
| InChIKey | PATXPXVIBYDPTB-UHFFFAOYSA-M |
| XLogP | -0.76 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.43 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |