C15H13ClO5S2 — CID 11773171
2-[4-chloro-2-(2-methylsulfonylphenyl)sulfanylphenoxy]acetic acid (PubChem CID 11773171) has the molecular formula C15H13ClO5S2 and a molecular weight of 372.85 g/mol. Its IUPAC name is 2-[4-chloro-2-(2-methylsulfonylphenyl)sulfanylphenoxy]acetic acid.
| Compound Name | 2-[4-chloro-2-(2-methylsulfonylphenyl)sulfanylphenoxy]acetic acid |
|---|---|
| PubChem CID | 11773171 |
| Molecular Formula | C15H13ClO5S2 |
| Molecular Weight | 372.85 g/mol |
| Exact Mass | 371.99 |
| IUPAC Name | 2-[4-chloro-2-(2-methylsulfonylphenyl)sulfanylphenoxy]acetic acid |
| SMILES | CS(=O)(=O)c1ccccc1Sc1cc(Cl)ccc1OCC(=O)O |
| InChI | InChI=1S/C15H13ClO5S2/c1-23(19,20)14-5-3-2-4-12(14)22-13-8-10(16)6-7-11(13)21-9-15(17)18/h2-8H,9H2,1H3,(H,17,18) |
| InChIKey | HNUXVOMXQYGQQK-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.85 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |