C15H13ClO6S2 — CID 11326709
2-[4-chloro-2-(4-methylsulfonylphenyl)sulfinylphenoxy]acetic acid (PubChem CID 11326709) has the molecular formula C15H13ClO6S2 and a molecular weight of 388.85 g/mol. Its IUPAC name is 2-[4-chloro-2-(4-methylsulfonylphenyl)sulfinylphenoxy]acetic acid.
| Compound Name | 2-[4-chloro-2-(4-methylsulfonylphenyl)sulfinylphenoxy]acetic acid |
|---|---|
| PubChem CID | 11326709 |
| Molecular Formula | C15H13ClO6S2 |
| Molecular Weight | 388.85 g/mol |
| Exact Mass | 387.98 |
| IUPAC Name | 2-[4-chloro-2-(4-methylsulfonylphenyl)sulfinylphenoxy]acetic acid |
| SMILES | CS(=O)(=O)c1ccc(S(=O)c2cc(Cl)ccc2OCC(=O)O)cc1 |
| InChI | InChI=1S/C15H13ClO6S2/c1-24(20,21)12-5-3-11(4-6-12)23(19)14-8-10(16)2-7-13(14)22-9-15(17)18/h2-8H,9H2,1H3,(H,17,18) |
| InChIKey | PVEGPGIMLMOMHO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.85 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |