C15H12Cl2N4O3S2 — CID 59850268
5-[[4-chloro-2-(2-chloro-4-methylsulfonylphenyl)sulfanylphenoxy]methyl]-2H-tetrazole (PubChem CID 59850268) has the molecular formula C15H12Cl2N4O3S2 and a molecular weight of 431.33 g/mol. Its IUPAC name is 5-[[4-chloro-2-(2-chloro-4-methylsulfonylphenyl)sulfanylphenoxy]methyl]-2H-tetrazole.
| Compound Name | 5-[[4-chloro-2-(2-chloro-4-methylsulfonylphenyl)sulfanylphenoxy]methyl]-2H-tetrazole |
|---|---|
| PubChem CID | 59850268 |
| Molecular Formula | C15H12Cl2N4O3S2 |
| Molecular Weight | 431.33 g/mol |
| Exact Mass | 429.97 |
| IUPAC Name | 5-[[4-chloro-2-(2-chloro-4-methylsulfonylphenyl)sulfanylphenoxy]methyl]-2H-tetrazole |
| SMILES | CS(=O)(=O)c1ccc(Sc2cc(Cl)ccc2OCc2nn[nH]n2)c(Cl)c1 |
| InChI | InChI=1S/C15H12Cl2N4O3S2/c1-26(22,23)10-3-5-13(11(17)7-10)25-14-6-9(16)2-4-12(14)24-8-15-18-20-21-19-15/h2-7H,8H2,1H3,(H,18,19,20,21) |
| InChIKey | JMJUNXAFDHECIV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.33 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |