C15H18N2O3 — CID 18752863
tert-butyl N-(3-formyl-4-methyl-1H-indol-7-yl)carbamate (PubChem CID 18752863) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is tert-butyl N-(3-formyl-4-methyl-1H-indol-7-yl)carbamate.
| Compound Name | tert-butyl N-(3-formyl-4-methyl-1H-indol-7-yl)carbamate |
|---|---|
| PubChem CID | 18752863 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | tert-butyl N-(3-formyl-4-methyl-1H-indol-7-yl)carbamate |
| SMILES | Cc1ccc(NC(=O)OC(C)(C)C)c2[nH]cc(C=O)c12 |
| InChI | InChI=1S/C15H18N2O3/c1-9-5-6-11(17-14(19)20-15(2,3)4)13-12(9)10(8-18)7-16-13/h5-8,16H,1-4H3,(H,17,19) |
| InChIKey | MZPMRRAPFVVVDI-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|