C39H40O6 — CID 18755717
2-[4-[2-[4-[2-(2-methylprop-2-enoyloxy)ethoxy]-3-phenylphenyl]propan-2-yl]-2-phenylphenoxy]ethyl 2-methylprop-2-enoate (PubChem CID 18755717) has the molecular formula C39H40O6 and a molecular weight of 604.74 g/mol. Its IUPAC name is 2-[4-[2-[4-[2-(2-methylprop-2-enoyloxy)ethoxy]-3-phenylphenyl]propan-2-yl]-2-phenylphenoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[4-[2-[4-[2-(2-methylprop-2-enoyloxy)ethoxy]-3-phenylphenyl]propan-2-yl]-2-phenylphenoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 18755717 |
| Molecular Formula | C39H40O6 |
| Molecular Weight | 604.74 g/mol |
| Exact Mass | 604.28 |
| IUPAC Name | 2-[4-[2-[4-[2-(2-methylprop-2-enoyloxy)ethoxy]-3-phenylphenyl]propan-2-yl]-2-phenylphenoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOc1ccc(C(C)(C)c2ccc(OCCOC(=O)C(=C)C)c(-c3ccccc3)c2)cc1-c1ccccc1 |
| InChI | InChI=1S/C39H40O6/c1-27(2)37(40)44-23-21-42-35-19-17-31(25-33(35)29-13-9-7-10-14-29)39(5,6)32-18-20-36(43-22-24-45-38(41)28(3)4)34(26-32)30-15-11-8-12-16-30/h7-20,25-26H,1,3,21-24H2,2,4-6H3 |
| InChIKey | FYFQKNPODNPNTJ-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.74 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|