C18H24O2 — CID 18761970
1,2-bis[(2-methylpropan-2-yl)oxy]naphthalene (PubChem CID 18761970) has the molecular formula C18H24O2 and a molecular weight of 272.39 g/mol. Its IUPAC name is 1,2-bis[(2-methylpropan-2-yl)oxy]naphthalene.
| Compound Name | 1,2-bis[(2-methylpropan-2-yl)oxy]naphthalene |
|---|---|
| PubChem CID | 18761970 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | 1,2-bis[(2-methylpropan-2-yl)oxy]naphthalene |
| SMILES | CC(C)(C)Oc1ccc2ccccc2c1OC(C)(C)C |
| InChI | InChI=1S/C18H24O2/c1-17(2,3)19-15-12-11-13-9-7-8-10-14(13)16(15)20-18(4,5)6/h7-12H,1-6H3 |
| InChIKey | SMPKBZNOCHMWHT-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |