C20H14N2O3 — CID 18762620
2-(4-phenoxyanilino)-3,1-benzoxazin-4-one (PubChem CID 18762620) has the molecular formula C20H14N2O3 and a molecular weight of 330.34 g/mol. Its IUPAC name is 2-(4-phenoxyanilino)-3,1-benzoxazin-4-one.
| Compound Name | 2-(4-phenoxyanilino)-3,1-benzoxazin-4-one |
|---|---|
| PubChem CID | 18762620 |
| Molecular Formula | C20H14N2O3 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 2-(4-phenoxyanilino)-3,1-benzoxazin-4-one |
| SMILES | O=c1oc(Nc2ccc(Oc3ccccc3)cc2)nc2ccccc12 |
| InChI | InChI=1S/C20H14N2O3/c23-19-17-8-4-5-9-18(17)22-20(25-19)21-14-10-12-16(13-11-14)24-15-6-2-1-3-7-15/h1-13H,(H,21,22) |
| InChIKey | HKFRGWMWWWWFHQ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |