C18H12N2O3S2 — CID 59767735
2-(4-phenoxysulfanylanilino)thieno[2,3-d][1,3]oxazin-4-one (PubChem CID 59767735) has the molecular formula C18H12N2O3S2 and a molecular weight of 368.44 g/mol. Its IUPAC name is 2-(4-phenoxysulfanylanilino)thieno[2,3-d][1,3]oxazin-4-one.
| Compound Name | 2-(4-phenoxysulfanylanilino)thieno[2,3-d][1,3]oxazin-4-one |
|---|---|
| PubChem CID | 59767735 |
| Molecular Formula | C18H12N2O3S2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | 2-(4-phenoxysulfanylanilino)thieno[2,3-d][1,3]oxazin-4-one |
| SMILES | O=c1oc(Nc2ccc(SOc3ccccc3)cc2)nc2sccc12 |
| InChI | InChI=1S/C18H12N2O3S2/c21-17-15-10-11-24-16(15)20-18(22-17)19-12-6-8-14(9-7-12)25-23-13-4-2-1-3-5-13/h1-11H,(H,19,20) |
| InChIKey | KHYXWNSJUFRABP-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|