C18H12N2O2S2 — CID 68977440
2-(2-phenylsulfanylanilino)thieno[2,3-d][1,3]oxazin-4-one (PubChem CID 68977440) has the molecular formula C18H12N2O2S2 and a molecular weight of 352.44 g/mol. Its IUPAC name is 2-(2-phenylsulfanylanilino)thieno[2,3-d][1,3]oxazin-4-one.
| Compound Name | 2-(2-phenylsulfanylanilino)thieno[2,3-d][1,3]oxazin-4-one |
|---|---|
| PubChem CID | 68977440 |
| Molecular Formula | C18H12N2O2S2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | 2-(2-phenylsulfanylanilino)thieno[2,3-d][1,3]oxazin-4-one |
| SMILES | O=c1oc(Nc2ccccc2Sc2ccccc2)nc2sccc12 |
| InChI | InChI=1S/C18H12N2O2S2/c21-17-13-10-11-23-16(13)20-18(22-17)19-14-8-4-5-9-15(14)24-12-6-2-1-3-7-12/h1-11H,(H,19,20) |
| InChIKey | VDGGWJJPRQXYBL-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |