C22H16N2O3 — CID 18762628
2-(4-benzoylanilino)-7-methyl-3,1-benzoxazin-4-one (PubChem CID 18762628) has the molecular formula C22H16N2O3 and a molecular weight of 356.38 g/mol. Its IUPAC name is 2-(4-benzoylanilino)-7-methyl-3,1-benzoxazin-4-one.
| Compound Name | 2-(4-benzoylanilino)-7-methyl-3,1-benzoxazin-4-one |
|---|---|
| PubChem CID | 18762628 |
| Molecular Formula | C22H16N2O3 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 2-(4-benzoylanilino)-7-methyl-3,1-benzoxazin-4-one |
| SMILES | Cc1ccc2c(=O)oc(Nc3ccc(C(=O)c4ccccc4)cc3)nc2c1 |
| InChI | InChI=1S/C22H16N2O3/c1-14-7-12-18-19(13-14)24-22(27-21(18)26)23-17-10-8-16(9-11-17)20(25)15-5-3-2-4-6-15/h2-13H,1H3,(H,23,24) |
| InChIKey | SRPVIUOVOOFGQQ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |