C23H30N4O2 — CID 18763014
tert-butyl N-[4-[3-[1-methyl-5-(methylamino)benzimidazol-2-yl]propyl]phenyl]carbamate (PubChem CID 18763014) has the molecular formula C23H30N4O2 and a molecular weight of 394.52 g/mol. Its IUPAC name is tert-butyl N-[4-[3-[1-methyl-5-(methylamino)benzimidazol-2-yl]propyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[3-[1-methyl-5-(methylamino)benzimidazol-2-yl]propyl]phenyl]carbamate |
|---|---|
| PubChem CID | 18763014 |
| Molecular Formula | C23H30N4O2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | tert-butyl N-[4-[3-[1-methyl-5-(methylamino)benzimidazol-2-yl]propyl]phenyl]carbamate |
| SMILES | CNc1ccc2c(c1)nc(CCCc1ccc(NC(=O)OC(C)(C)C)cc1)n2C |
| InChI | InChI=1S/C23H30N4O2/c1-23(2,3)29-22(28)25-17-11-9-16(10-12-17)7-6-8-21-26-19-15-18(24-4)13-14-20(19)27(21)5/h9-15,24H,6-8H2,1-5H3,(H,25,28) |
| InChIKey | FRYFNMQEHJVXTE-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |