C15H21N3O3S — CID 142313913
tert-butyl N-[6-hydroxy-3-methyl-2-(2-sulfanylethyl)benzimidazol-5-yl]carbamate (PubChem CID 142313913) has the molecular formula C15H21N3O3S and a molecular weight of 323.42 g/mol. Its IUPAC name is tert-butyl N-[6-hydroxy-3-methyl-2-(2-sulfanylethyl)benzimidazol-5-yl]carbamate.
| Compound Name | tert-butyl N-[6-hydroxy-3-methyl-2-(2-sulfanylethyl)benzimidazol-5-yl]carbamate |
|---|---|
| PubChem CID | 142313913 |
| Molecular Formula | C15H21N3O3S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | tert-butyl N-[6-hydroxy-3-methyl-2-(2-sulfanylethyl)benzimidazol-5-yl]carbamate |
| SMILES | Cn1c(CCS)nc2cc(O)c(NC(=O)OC(C)(C)C)cc21 |
| InChI | InChI=1S/C15H21N3O3S/c1-15(2,3)21-14(20)17-10-7-11-9(8-12(10)19)16-13(5-6-22)18(11)4/h7-8,19,22H,5-6H2,1-4H3,(H,17,20) |
| InChIKey | GQZSNUIZMLOQPR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|