About sodium 2-methanidylpropane
sodium 2-methanidylpropane (PubChem CID 18764428) has the molecular formula C4H9Na
and a molecular weight of 80.11 g/mol. Its IUPAC name is sodium 2-methanidylpropane.
Molecular Properties
| Compound Name | sodium 2-methanidylpropane |
| PubChem CID | 18764428 |
| Molecular Formula | C4H9Na |
| Molecular Weight | 80.11 g/mol |
| Exact Mass | 80.06 |
| IUPAC Name | sodium 2-methanidylpropane |
| SMILES | [CH2-]C(C)C.[Na+] |
| InChI | InChI=1S/C4H9.Na/c1-4(2)3;/h4H,1H2,2-3H3;/q-1;+1 |
| InChIKey | WSOUKJQSABOGAZ-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 80.11 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze sodium 2-methanidylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-methanidylpropane?
The IUPAC name of sodium 2-methanidylpropane (CID 18764428) is sodium 2-methanidylpropane.
What is the SMILES notation for sodium 2-methanidylpropane?
The canonical SMILES for sodium 2-methanidylpropane is [CH2-]C(C)C.[Na+].
What is the InChIKey of sodium 2-methanidylpropane?
The InChIKey is WSOUKJQSABOGAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9.Na/c1-4(2)3;/h4H,1H2,2-3H3;/q-1;+1.
What are the key properties of sodium 2-methanidylpropane?
sodium 2-methanidylpropane has a molecular weight of 80.11 g/mol, XLogP of -1.52, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-methanidylpropane is sourced from PubChem (CID 18764428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).