C20H31NO4 — CID 18766558
tert-butyl 2-methyl-2-[4-[3-oxo-3-(propylamino)propyl]phenoxy]propanoate (PubChem CID 18766558) has the molecular formula C20H31NO4 and a molecular weight of 349.47 g/mol. Its IUPAC name is tert-butyl 2-methyl-2-[4-[3-oxo-3-(propylamino)propyl]phenoxy]propanoate.
| Compound Name | tert-butyl 2-methyl-2-[4-[3-oxo-3-(propylamino)propyl]phenoxy]propanoate |
|---|---|
| PubChem CID | 18766558 |
| Molecular Formula | C20H31NO4 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | tert-butyl 2-methyl-2-[4-[3-oxo-3-(propylamino)propyl]phenoxy]propanoate |
| SMILES | CCCNC(=O)CCc1ccc(OC(C)(C)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C20H31NO4/c1-7-14-21-17(22)13-10-15-8-11-16(12-9-15)24-20(5,6)18(23)25-19(2,3)4/h8-9,11-12H,7,10,13-14H2,1-6H3,(H,21,22) |
| InChIKey | ZGTPGIXZBZSKOV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |