C22H30N4O4 — CID 18767666
3-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)adamantane-1-carboxylic acid (PubChem CID 18767666) has the molecular formula C22H30N4O4 and a molecular weight of 414.51 g/mol. Its IUPAC name is 3-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)adamantane-1-carboxylic acid.
| Compound Name | 3-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)adamantane-1-carboxylic acid |
|---|---|
| PubChem CID | 18767666 |
| Molecular Formula | C22H30N4O4 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | 3-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)adamantane-1-carboxylic acid |
| SMILES | CCCn1c(=O)c2[nH]c(C34CC5CC(CC(C(=O)O)(C5)C3)C4)nc2n(CCC)c1=O |
| InChI | InChI=1S/C22H30N4O4/c1-3-5-25-16-15(17(27)26(6-4-2)20(25)30)23-18(24-16)21-8-13-7-14(9-21)11-22(10-13,12-21)19(28)29/h13-14H,3-12H2,1-2H3,(H,23,24)(H,28,29) |
| InChIKey | OCEMRWLMTJLXLN-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |