C25H40N2O4 — CID 18768905
tert-butyl N-(4-tert-butylcyclohexyl)-N-[[4-[methoxy(methyl)carbamoyl]phenyl]methyl]carbamate (PubChem CID 18768905) has the molecular formula C25H40N2O4 and a molecular weight of 432.61 g/mol. Its IUPAC name is tert-butyl N-(4-tert-butylcyclohexyl)-N-[[4-[methoxy(methyl)carbamoyl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-(4-tert-butylcyclohexyl)-N-[[4-[methoxy(methyl)carbamoyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 18768905 |
| Molecular Formula | C25H40N2O4 |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.30 |
| IUPAC Name | tert-butyl N-(4-tert-butylcyclohexyl)-N-[[4-[methoxy(methyl)carbamoyl]phenyl]methyl]carbamate |
| SMILES | CON(C)C(=O)c1ccc(CN(C(=O)OC(C)(C)C)C2CCC(C(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C25H40N2O4/c1-24(2,3)20-13-15-21(16-14-20)27(23(29)31-25(4,5)6)17-18-9-11-19(12-10-18)22(28)26(7)30-8/h9-12,20-21H,13-17H2,1-8H3 |
| InChIKey | NAWUDQDUNYQUKD-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|