C28H48Si — CID 18778904
bis(3-butyl-5-tert-butylcyclopenta-1,4-dien-1-yl)-dimethylsilane (PubChem CID 18778904) has the molecular formula C28H48Si and a molecular weight of 412.78 g/mol. Its IUPAC name is bis(3-butyl-5-tert-butylcyclopenta-1,4-dien-1-yl)-dimethylsilane.
| Compound Name | bis(3-butyl-5-tert-butylcyclopenta-1,4-dien-1-yl)-dimethylsilane |
|---|---|
| PubChem CID | 18778904 |
| Molecular Formula | C28H48Si |
| Molecular Weight | 412.78 g/mol |
| Exact Mass | 412.35 |
| IUPAC Name | bis(3-butyl-5-tert-butylcyclopenta-1,4-dien-1-yl)-dimethylsilane |
| SMILES | CCCCC1C=C(C(C)(C)C)C([Si](C)(C)C2=CC(CCCC)C=C2C(C)(C)C)=C1 |
| InChI | InChI=1S/C28H48Si/c1-11-13-15-21-17-23(27(3,4)5)25(19-21)29(9,10)26-20-22(16-14-12-2)18-24(26)28(6,7)8/h17-22H,11-16H2,1-10H3 |
| InChIKey | NASVLVJAFBXVDF-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.78 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|