About 9-methyl-4b,8a,9,9a-tetrahydro-4aH-fluorene
9-methyl-4b,8a,9,9a-tetrahydro-4aH-fluorene (PubChem CID 18783453) has the molecular formula C14H16
and a molecular weight of 184.28 g/mol. Its IUPAC name is 9-methyl-4b,8a,9,9a-tetrahydro-4aH-fluorene.
Molecular Properties
| Compound Name | 9-methyl-4b,8a,9,9a-tetrahydro-4aH-fluorene |
| PubChem CID | 18783453 |
| Molecular Formula | C14H16 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | 9-methyl-4b,8a,9,9a-tetrahydro-4aH-fluorene |
| SMILES | CC1C2C=CC=CC2C2C=CC=CC12 |
| InChI | InChI=1S/C14H16/c1-10-11-6-2-4-8-13(11)14-9-5-3-7-12(10)14/h2-14H,1H3 |
| InChIKey | SYDXONFYISETFN-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 9-methyl-4b,8a,9,9a-tetrahydro-4aH-fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methyl-4b,8a,9,9a-tetrahydro-4aH-fluorene?
The IUPAC name of 9-methyl-4b,8a,9,9a-tetrahydro-4aH-fluorene (CID 18783453) is 9-methyl-4b,8a,9,9a-tetrahydro-4aH-fluorene.
What is the SMILES notation for 9-methyl-4b,8a,9,9a-tetrahydro-4aH-fluorene?
The canonical SMILES for 9-methyl-4b,8a,9,9a-tetrahydro-4aH-fluorene is CC1C2C=CC=CC2C2C=CC=CC12.
What is the InChIKey of 9-methyl-4b,8a,9,9a-tetrahydro-4aH-fluorene?
The InChIKey is SYDXONFYISETFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16/c1-10-11-6-2-4-8-13(11)14-9-5-3-7-12(10)14/h2-14H,1H3.
What are the key properties of 9-methyl-4b,8a,9,9a-tetrahydro-4aH-fluorene?
9-methyl-4b,8a,9,9a-tetrahydro-4aH-fluorene has a molecular weight of 184.28 g/mol, XLogP of 3.35, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methyl-4b,8a,9,9a-tetrahydro-4aH-fluorene is sourced from PubChem (CID 18783453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).