C22H27NO4 — CID 18788193
[3-[1-[2-(butoxycarbonylamino)phenyl]propyl]phenyl] acetate (PubChem CID 18788193) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is [3-[1-[2-(butoxycarbonylamino)phenyl]propyl]phenyl] acetate.
| Compound Name | [3-[1-[2-(butoxycarbonylamino)phenyl]propyl]phenyl] acetate |
|---|---|
| PubChem CID | 18788193 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | [3-[1-[2-(butoxycarbonylamino)phenyl]propyl]phenyl] acetate |
| SMILES | CCCCOC(=O)Nc1ccccc1C(CC)c1cccc(OC(C)=O)c1 |
| InChI | InChI=1S/C22H27NO4/c1-4-6-14-26-22(25)23-21-13-8-7-12-20(21)19(5-2)17-10-9-11-18(15-17)27-16(3)24/h7-13,15,19H,4-6,14H2,1-3H3,(H,23,25) |
| InChIKey | AISKPAAIBBTGKG-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|