About bromate;hypochlorite;iodate
bromate;hypochlorite;iodate (PubChem CID 18790828) has the molecular formula BrClIO7-3
and a molecular weight of 354.25 g/mol. Its IUPAC name is bromate;hypochlorite;iodate.
Molecular Properties
| Compound Name | bromate;hypochlorite;iodate |
| PubChem CID | 18790828 |
| Molecular Formula | BrClIO7-3 |
| Molecular Weight | 354.25 g/mol |
| Exact Mass | 352.76 |
| IUPAC Name | bromate;hypochlorite;iodate |
| SMILES | [O-]Cl.[O-][Br+2]([O-])[O-].[O-][I+2]([O-])[O-] |
| InChI | InChI=1S/BrO3.ClO.IO3/c2-1(3)4;1-2;2-1(3)4/q3*-1 |
| InChIKey | AXNLLJAUIJXXML-UHFFFAOYSA-N |
| XLogP | -10.63 |
| TPSA | 161.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.25 |
| LogP ≤ 5 | -10.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze bromate;hypochlorite;iodate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromate;hypochlorite;iodate?
The IUPAC name of bromate;hypochlorite;iodate (CID 18790828) is bromate;hypochlorite;iodate.
What is the SMILES notation for bromate;hypochlorite;iodate?
The canonical SMILES for bromate;hypochlorite;iodate is [O-]Cl.[O-][Br+2]([O-])[O-].[O-][I+2]([O-])[O-].
What is the InChIKey of bromate;hypochlorite;iodate?
The InChIKey is AXNLLJAUIJXXML-UHFFFAOYSA-N. The full InChI is InChI=1S/BrO3.ClO.IO3/c2-1(3)4;1-2;2-1(3)4/q3*-1.
What are the key properties of bromate;hypochlorite;iodate?
bromate;hypochlorite;iodate has a molecular weight of 354.25 g/mol, XLogP of -10.63, 0 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for bromate;hypochlorite;iodate is sourced from PubChem (CID 18790828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).