C18H17ClO4S — CID 18794411
2-(chloromethyl)-5,6-dimethoxy-3-(4-methoxyphenoxy)-1-benzothiophene (PubChem CID 18794411) has the molecular formula C18H17ClO4S and a molecular weight of 364.85 g/mol. Its IUPAC name is 2-(chloromethyl)-5,6-dimethoxy-3-(4-methoxyphenoxy)-1-benzothiophene.
| Compound Name | 2-(chloromethyl)-5,6-dimethoxy-3-(4-methoxyphenoxy)-1-benzothiophene |
|---|---|
| PubChem CID | 18794411 |
| Molecular Formula | C18H17ClO4S |
| Molecular Weight | 364.85 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | 2-(chloromethyl)-5,6-dimethoxy-3-(4-methoxyphenoxy)-1-benzothiophene |
| SMILES | COc1ccc(Oc2c(CCl)sc3cc(OC)c(OC)cc23)cc1 |
| InChI | InChI=1S/C18H17ClO4S/c1-20-11-4-6-12(7-5-11)23-18-13-8-14(21-2)15(22-3)9-16(13)24-17(18)10-19/h4-9H,10H2,1-3H3 |
| InChIKey | QQTYGIQPOQDLES-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.85 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|