About methyl 5-oxo-6-prop-2-enyl-7,8-dihydro-6H-naphthalene-1-carboxylate
methyl 5-oxo-6-prop-2-enyl-7,8-dihydro-6H-naphthalene-1-carboxylate (PubChem CID 18794675) has the molecular formula C15H16O3
and a molecular weight of 244.29 g/mol. Its IUPAC name is methyl 5-oxo-6-prop-2-enyl-7,8-dihydro-6H-naphthalene-1-carboxylate.
Molecular Properties
| Compound Name | methyl 5-oxo-6-prop-2-enyl-7,8-dihydro-6H-naphthalene-1-carboxylate |
| PubChem CID | 18794675 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | methyl 5-oxo-6-prop-2-enyl-7,8-dihydro-6H-naphthalene-1-carboxylate |
| SMILES | C=CCC1CCc2c(C(=O)OC)cccc2C1=O |
| InChI | InChI=1S/C15H16O3/c1-3-5-10-8-9-11-12(14(10)16)6-4-7-13(11)15(17)18-2/h3-4,6-7,10H,1,5,8-9H2,2H3 |
| InChIKey | UQLRMBZFEVRCGP-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-oxo-6-prop-2-enyl-7,8-dihydro-6H-naphthalene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-oxo-6-prop-2-enyl-7,8-dihydro-6H-naphthalene-1-carboxylate?
The IUPAC name of methyl 5-oxo-6-prop-2-enyl-7,8-dihydro-6H-naphthalene-1-carboxylate (CID 18794675) is methyl 5-oxo-6-prop-2-enyl-7,8-dihydro-6H-naphthalene-1-carboxylate.
What is the SMILES notation for methyl 5-oxo-6-prop-2-enyl-7,8-dihydro-6H-naphthalene-1-carboxylate?
The canonical SMILES for methyl 5-oxo-6-prop-2-enyl-7,8-dihydro-6H-naphthalene-1-carboxylate is C=CCC1CCc2c(C(=O)OC)cccc2C1=O.
What is the InChIKey of methyl 5-oxo-6-prop-2-enyl-7,8-dihydro-6H-naphthalene-1-carboxylate?
The InChIKey is UQLRMBZFEVRCGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O3/c1-3-5-10-8-9-11-12(14(10)16)6-4-7-13(11)15(17)18-2/h3-4,6-7,10H,1,5,8-9H2,2H3.
What are the key properties of methyl 5-oxo-6-prop-2-enyl-7,8-dihydro-6H-naphthalene-1-carboxylate?
methyl 5-oxo-6-prop-2-enyl-7,8-dihydro-6H-naphthalene-1-carboxylate has a molecular weight of 244.29 g/mol, XLogP of 2.79, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-oxo-6-prop-2-enyl-7,8-dihydro-6H-naphthalene-1-carboxylate is sourced from PubChem (CID 18794675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).