C13H13NO5S — CID 89372936
methyl 2,2,4-trioxo-1-prop-2-enyl-2λ6,1-benzothiazine-8-carboxylate (PubChem CID 89372936) has the molecular formula C13H13NO5S and a molecular weight of 295.32 g/mol. Its IUPAC name is methyl 2,2,4-trioxo-1-prop-2-enyl-2λ6,1-benzothiazine-8-carboxylate.
| Compound Name | methyl 2,2,4-trioxo-1-prop-2-enyl-2λ6,1-benzothiazine-8-carboxylate |
|---|---|
| PubChem CID | 89372936 |
| Molecular Formula | C13H13NO5S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | methyl 2,2,4-trioxo-1-prop-2-enyl-2λ6,1-benzothiazine-8-carboxylate |
| SMILES | C=CCN1c2c(cccc2C(=O)OC)C(=O)CS1(=O)=O |
| InChI | InChI=1S/C13H13NO5S/c1-3-7-14-12-9(11(15)8-20(14,17)18)5-4-6-10(12)13(16)19-2/h3-6H,1,7-8H2,2H3 |
| InChIKey | DBZQGBOOZFBWKG-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|