C12H12N2O4S2 — CID 135317535
methyl 1,1-dioxo-2-prop-2-enyl-5-thiophen-2-yl-1,2,6-thiadiazine-3-carboxylate (PubChem CID 135317535) has the molecular formula C12H12N2O4S2 and a molecular weight of 312.37 g/mol. Its IUPAC name is methyl 1,1-dioxo-2-prop-2-enyl-5-thiophen-2-yl-1,2,6-thiadiazine-3-carboxylate.
| Compound Name | methyl 1,1-dioxo-2-prop-2-enyl-5-thiophen-2-yl-1,2,6-thiadiazine-3-carboxylate |
|---|---|
| PubChem CID | 135317535 |
| Molecular Formula | C12H12N2O4S2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | methyl 1,1-dioxo-2-prop-2-enyl-5-thiophen-2-yl-1,2,6-thiadiazine-3-carboxylate |
| SMILES | C=CCN1C(C(=O)OC)=CC(c2cccs2)=NS1(=O)=O |
| InChI | InChI=1S/C12H12N2O4S2/c1-3-6-14-10(12(15)18-2)8-9(13-20(14,16)17)11-5-4-7-19-11/h3-5,7-8H,1,6H2,2H3 |
| InChIKey | CCQGSFBKDVBWEU-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|