C17H17N3O5S2 — CID 135317540
methyl 1,1-dioxo-2-(2-phenylmethoxyethyl)-5-(1,3-thiazol-2-yl)-1,2,6-thiadiazine-3-carboxylate (PubChem CID 135317540) has the molecular formula C17H17N3O5S2 and a molecular weight of 407.47 g/mol. Its IUPAC name is methyl 1,1-dioxo-2-(2-phenylmethoxyethyl)-5-(1,3-thiazol-2-yl)-1,2,6-thiadiazine-3-carboxylate.
| Compound Name | methyl 1,1-dioxo-2-(2-phenylmethoxyethyl)-5-(1,3-thiazol-2-yl)-1,2,6-thiadiazine-3-carboxylate |
|---|---|
| PubChem CID | 135317540 |
| Molecular Formula | C17H17N3O5S2 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | methyl 1,1-dioxo-2-(2-phenylmethoxyethyl)-5-(1,3-thiazol-2-yl)-1,2,6-thiadiazine-3-carboxylate |
| SMILES | COC(=O)C1=CC(c2nccs2)=NS(=O)(=O)N1CCOCc1ccccc1 |
| InChI | InChI=1S/C17H17N3O5S2/c1-24-17(21)15-11-14(16-18-7-10-26-16)19-27(22,23)20(15)8-9-25-12-13-5-3-2-4-6-13/h2-7,10-11H,8-9,12H2,1H3 |
| InChIKey | CCVJCMOMZFKWLH-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 98.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|