C23H29N3O3S — CID 71521599
4-[2-(phenylmethoxymethyl)-4-(1,3-thiazol-2-yl)imidazol-1-yl]butyl 2,2-dimethylpropanoate (PubChem CID 71521599) has the molecular formula C23H29N3O3S and a molecular weight of 427.57 g/mol. Its IUPAC name is 4-[2-(phenylmethoxymethyl)-4-(1,3-thiazol-2-yl)imidazol-1-yl]butyl 2,2-dimethylpropanoate.
| Compound Name | 4-[2-(phenylmethoxymethyl)-4-(1,3-thiazol-2-yl)imidazol-1-yl]butyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 71521599 |
| Molecular Formula | C23H29N3O3S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 4-[2-(phenylmethoxymethyl)-4-(1,3-thiazol-2-yl)imidazol-1-yl]butyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCCCCn1cc(-c2nccs2)nc1COCc1ccccc1 |
| InChI | InChI=1S/C23H29N3O3S/c1-23(2,3)22(27)29-13-8-7-12-26-15-19(21-24-11-14-30-21)25-20(26)17-28-16-18-9-5-4-6-10-18/h4-6,9-11,14-15H,7-8,12-13,16-17H2,1-3H3 |
| InChIKey | GDBGBIWUDYSKRM-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|