C29H29F3N2O3 — CID 18797016
4-(4-acetylphenyl)-N-[4-[7-(trifluoromethoxy)-3,4-dihydro-1H-isoquinolin-2-yl]butyl]benzamide (PubChem CID 18797016) has the molecular formula C29H29F3N2O3 and a molecular weight of 510.56 g/mol. Its IUPAC name is 4-(4-acetylphenyl)-N-[4-[7-(trifluoromethoxy)-3,4-dihydro-1H-isoquinolin-2-yl]butyl]benzamide.
| Compound Name | 4-(4-acetylphenyl)-N-[4-[7-(trifluoromethoxy)-3,4-dihydro-1H-isoquinolin-2-yl]butyl]benzamide |
|---|---|
| PubChem CID | 18797016 |
| Molecular Formula | C29H29F3N2O3 |
| Molecular Weight | 510.56 g/mol |
| Exact Mass | 510.21 |
| IUPAC Name | 4-(4-acetylphenyl)-N-[4-[7-(trifluoromethoxy)-3,4-dihydro-1H-isoquinolin-2-yl]butyl]benzamide |
| SMILES | CC(=O)c1ccc(-c2ccc(C(=O)NCCCCN3CCc4ccc(OC(F)(F)F)cc4C3)cc2)cc1 |
| InChI | InChI=1S/C29H29F3N2O3/c1-20(35)21-4-6-22(7-5-21)23-8-10-25(11-9-23)28(36)33-15-2-3-16-34-17-14-24-12-13-27(18-26(24)19-34)37-29(30,31)32/h4-13,18H,2-3,14-17,19H2,1H3,(H,33,36) |
| InChIKey | AHUKKTDFLFSRLS-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.56 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|