C14H15ClN2 — CID 18797343
4-chloro-3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indole (PubChem CID 18797343) has the molecular formula C14H15ClN2 and a molecular weight of 246.74 g/mol. Its IUPAC name is 4-chloro-3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indole.
| Compound Name | 4-chloro-3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indole |
|---|---|
| PubChem CID | 18797343 |
| Molecular Formula | C14H15ClN2 |
| Molecular Weight | 246.74 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 4-chloro-3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indole |
| SMILES | CN1CC=C(c2c[nH]c3cccc(Cl)c23)CC1 |
| InChI | InChI=1S/C14H15ClN2/c1-17-7-5-10(6-8-17)11-9-16-13-4-2-3-12(15)14(11)13/h2-5,9,16H,6-8H2,1H3 |
| InChIKey | DYIBRBCWTGBIRJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.74 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |