C20H29N5O3 — CID 18798253
6-[3-[2-(2-methoxyphenyl)piperazin-1-yl]propylamino]-1,3-dimethylpyrimidine-2,4-dione (PubChem CID 18798253) has the molecular formula C20H29N5O3 and a molecular weight of 387.48 g/mol. Its IUPAC name is 6-[3-[2-(2-methoxyphenyl)piperazin-1-yl]propylamino]-1,3-dimethylpyrimidine-2,4-dione.
| Compound Name | 6-[3-[2-(2-methoxyphenyl)piperazin-1-yl]propylamino]-1,3-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 18798253 |
| Molecular Formula | C20H29N5O3 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | 6-[3-[2-(2-methoxyphenyl)piperazin-1-yl]propylamino]-1,3-dimethylpyrimidine-2,4-dione |
| SMILES | COc1ccccc1C1CNCCN1CCCNc1cc(=O)n(C)c(=O)n1C |
| InChI | InChI=1S/C20H29N5O3/c1-23-18(13-19(26)24(2)20(23)27)22-9-6-11-25-12-10-21-14-16(25)15-7-4-5-8-17(15)28-3/h4-5,7-8,13,16,21-22H,6,9-12,14H2,1-3H3 |
| InChIKey | GCKCOFDHXRUYBH-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 80.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|