C16H27ClN2O3S — CID 120753314
2-(2-methoxyphenyl)-1-(2-propan-2-ylsulfonylethyl)piperazine;hydrochloride (PubChem CID 120753314) has the molecular formula C16H27ClN2O3S and a molecular weight of 362.92 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-1-(2-propan-2-ylsulfonylethyl)piperazine;hydrochloride.
| Compound Name | 2-(2-methoxyphenyl)-1-(2-propan-2-ylsulfonylethyl)piperazine;hydrochloride |
|---|---|
| PubChem CID | 120753314 |
| Molecular Formula | C16H27ClN2O3S |
| Molecular Weight | 362.92 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 2-(2-methoxyphenyl)-1-(2-propan-2-ylsulfonylethyl)piperazine;hydrochloride |
| SMILES | COc1ccccc1C1CNCCN1CCS(=O)(=O)C(C)C.Cl |
| InChI | InChI=1S/C16H26N2O3S.ClH/c1-13(2)22(19,20)11-10-18-9-8-17-12-15(18)14-6-4-5-7-16(14)21-3;/h4-7,13,15,17H,8-12H2,1-3H3;1H |
| InChIKey | QYDGJRBCHKAEDY-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.92 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |