C29H44N2O4 — CID 18799502
2-amino-2-(1-ethylpyrrolidin-2-yl)-1-[3,4,5-tris(3-methylbut-2-enoxy)phenyl]ethanone (PubChem CID 18799502) has the molecular formula C29H44N2O4 and a molecular weight of 484.68 g/mol. Its IUPAC name is 2-amino-2-(1-ethylpyrrolidin-2-yl)-1-[3,4,5-tris(3-methylbut-2-enoxy)phenyl]ethanone.
| Compound Name | 2-amino-2-(1-ethylpyrrolidin-2-yl)-1-[3,4,5-tris(3-methylbut-2-enoxy)phenyl]ethanone |
|---|---|
| PubChem CID | 18799502 |
| Molecular Formula | C29H44N2O4 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.33 |
| IUPAC Name | 2-amino-2-(1-ethylpyrrolidin-2-yl)-1-[3,4,5-tris(3-methylbut-2-enoxy)phenyl]ethanone |
| SMILES | CCN1CCCC1C(N)C(=O)c1cc(OCC=C(C)C)c(OCC=C(C)C)c(OCC=C(C)C)c1 |
| InChI | InChI=1S/C29H44N2O4/c1-8-31-14-9-10-24(31)27(30)28(32)23-18-25(33-15-11-20(2)3)29(35-17-13-22(6)7)26(19-23)34-16-12-21(4)5/h11-13,18-19,24,27H,8-10,14-17,30H2,1-7H3 |
| InChIKey | SOHDOKSZNBVLRU-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|