C20H20ClN3O — CID 18801217
8-benzyl-1-(4-chlorophenyl)-1,3,8-triazaspiro[4.5]dec-2-en-4-one (PubChem CID 18801217) has the molecular formula C20H20ClN3O and a molecular weight of 353.85 g/mol. Its IUPAC name is 8-benzyl-1-(4-chlorophenyl)-1,3,8-triazaspiro[4.5]dec-2-en-4-one.
| Compound Name | 8-benzyl-1-(4-chlorophenyl)-1,3,8-triazaspiro[4.5]dec-2-en-4-one |
|---|---|
| PubChem CID | 18801217 |
| Molecular Formula | C20H20ClN3O |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 8-benzyl-1-(4-chlorophenyl)-1,3,8-triazaspiro[4.5]dec-2-en-4-one |
| SMILES | O=C1N=CN(c2ccc(Cl)cc2)C12CCN(Cc1ccccc1)CC2 |
| InChI | InChI=1S/C20H20ClN3O/c21-17-6-8-18(9-7-17)24-15-22-19(25)20(24)10-12-23(13-11-20)14-16-4-2-1-3-5-16/h1-9,15H,10-14H2 |
| InChIKey | JAEHRJNISMZWCV-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |