5-(3-amino-4,6-dimethyl-2-pyridinyl)thiophene-2-carboxylic acid

C12H12N2O2S — CID 18801314

IUPAC5-(3-amino-4,6-dimethyl-2-pyridinyl)thiophene-2-carboxylic acid
SMILESCc1cc(C)c(N)c(-c2ccc(C(=O)O)s2)n1
InChIInChI=1S/C12H12N2O2S/c1-6-5-7(2)14-11(10(6)13)8-3-4-9(17-8)12(15)16/h3-5H,13H2,1-2H3,(H,15,16)
InChIKeyNNPFYRVAYMPQHE-UHFFFAOYSA-N
MW248.31 g/mol
LogP2.71
Rot. Bonds2

About 5-(3-amino-4,6-dimethyl-2-pyridinyl)thiophene-2-carboxylic acid

5-(3-amino-4,6-dimethyl-2-pyridinyl)thiophene-2-carboxylic acid (PubChem CID 18801314) has the molecular formula C12H12N2O2S and a molecular weight of 248.31 g/mol. Its IUPAC name is 5-(3-amino-4,6-dimethyl-2-pyridinyl)thiophene-2-carboxylic acid.

Molecular Properties

Compound Name5-(3-amino-4,6-dimethyl-2-pyridinyl)thiophene-2-carboxylic acid
PubChem CID18801314
Molecular FormulaC12H12N2O2S
Molecular Weight248.31 g/mol
Exact Mass248.06
IUPAC Name5-(3-amino-4,6-dimethyl-2-pyridinyl)thiophene-2-carboxylic acid
SMILESCc1cc(C)c(N)c(-c2ccc(C(=O)O)s2)n1
InChIInChI=1S/C12H12N2O2S/c1-6-5-7(2)14-11(10(6)13)8-3-4-9(17-8)12(15)16/h3-5H,13H2,1-2H3,(H,15,16)
InChIKeyNNPFYRVAYMPQHE-UHFFFAOYSA-N
XLogP2.71
TPSA76.21 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.31
LogP ≤ 52.71
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 5-(3-amino-4,6-dimethyl-2-pyridinyl)thiophene-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(3-amino-4,6-dimethyl-2-pyridinyl)thiophene-2-carboxylic acid?
The IUPAC name of 5-(3-amino-4,6-dimethyl-2-pyridinyl)thiophene-2-carboxylic acid (CID 18801314) is 5-(3-amino-4,6-dimethyl-2-pyridinyl)thiophene-2-carboxylic acid.
What is the SMILES notation for 5-(3-amino-4,6-dimethyl-2-pyridinyl)thiophene-2-carboxylic acid?
The canonical SMILES for 5-(3-amino-4,6-dimethyl-2-pyridinyl)thiophene-2-carboxylic acid is Cc1cc(C)c(N)c(-c2ccc(C(=O)O)s2)n1.
What is the InChIKey of 5-(3-amino-4,6-dimethyl-2-pyridinyl)thiophene-2-carboxylic acid?
The InChIKey is NNPFYRVAYMPQHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O2S/c1-6-5-7(2)14-11(10(6)13)8-3-4-9(17-8)12(15)16/h3-5H,13H2,1-2H3,(H,15,16).
What are the key properties of 5-(3-amino-4,6-dimethyl-2-pyridinyl)thiophene-2-carboxylic acid?
5-(3-amino-4,6-dimethyl-2-pyridinyl)thiophene-2-carboxylic acid has a molecular weight of 248.31 g/mol, XLogP of 2.71, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-amino-4,6-dimethyl-2-pyridinyl)thiophene-2-carboxylic acid is sourced from PubChem (CID 18801314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).