C10H11BrN2O3 — CID 18802739
2-[(2-amino-2-oxoethyl)amino]-3-bromo-5-methylbenzoic acid (PubChem CID 18802739) has the molecular formula C10H11BrN2O3 and a molecular weight of 287.11 g/mol. Its IUPAC name is 2-[(2-amino-2-oxoethyl)amino]-3-bromo-5-methylbenzoic acid.
| Compound Name | 2-[(2-amino-2-oxoethyl)amino]-3-bromo-5-methylbenzoic acid |
|---|---|
| PubChem CID | 18802739 |
| Molecular Formula | C10H11BrN2O3 |
| Molecular Weight | 287.11 g/mol |
| Exact Mass | 286.00 |
| IUPAC Name | 2-[(2-amino-2-oxoethyl)amino]-3-bromo-5-methylbenzoic acid |
| SMILES | Cc1cc(Br)c(NCC(N)=O)c(C(=O)O)c1 |
| InChI | InChI=1S/C10H11BrN2O3/c1-5-2-6(10(15)16)9(7(11)3-5)13-4-8(12)14/h2-3,13H,4H2,1H3,(H2,12,14)(H,15,16) |
| InChIKey | FZTAMTQVPZDKLY-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.11 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |