C18H20BrNO3 — CID 18802749
3-bromo-2-[2-(2,5-dimethylphenoxy)ethylamino]-5-methylbenzoic acid (PubChem CID 18802749) has the molecular formula C18H20BrNO3 and a molecular weight of 378.27 g/mol. Its IUPAC name is 3-bromo-2-[2-(2,5-dimethylphenoxy)ethylamino]-5-methylbenzoic acid.
| Compound Name | 3-bromo-2-[2-(2,5-dimethylphenoxy)ethylamino]-5-methylbenzoic acid |
|---|---|
| PubChem CID | 18802749 |
| Molecular Formula | C18H20BrNO3 |
| Molecular Weight | 378.27 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | 3-bromo-2-[2-(2,5-dimethylphenoxy)ethylamino]-5-methylbenzoic acid |
| SMILES | Cc1ccc(C)c(OCCNc2c(Br)cc(C)cc2C(=O)O)c1 |
| InChI | InChI=1S/C18H20BrNO3/c1-11-4-5-13(3)16(10-11)23-7-6-20-17-14(18(21)22)8-12(2)9-15(17)19/h4-5,8-10,20H,6-7H2,1-3H3,(H,21,22) |
| InChIKey | FAKVDBHUTPXGFY-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.27 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|