C17H16BrCl2NO3 — CID 18803050
methyl 5-bromo-2-[3-(3,4-dichlorophenoxy)propylamino]benzoate (PubChem CID 18803050) has the molecular formula C17H16BrCl2NO3 and a molecular weight of 433.13 g/mol. Its IUPAC name is methyl 5-bromo-2-[3-(3,4-dichlorophenoxy)propylamino]benzoate.
| Compound Name | methyl 5-bromo-2-[3-(3,4-dichlorophenoxy)propylamino]benzoate |
|---|---|
| PubChem CID | 18803050 |
| Molecular Formula | C17H16BrCl2NO3 |
| Molecular Weight | 433.13 g/mol |
| Exact Mass | 430.97 |
| IUPAC Name | methyl 5-bromo-2-[3-(3,4-dichlorophenoxy)propylamino]benzoate |
| SMILES | COC(=O)c1cc(Br)ccc1NCCCOc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H16BrCl2NO3/c1-23-17(22)13-9-11(18)3-6-16(13)21-7-2-8-24-12-4-5-14(19)15(20)10-12/h3-6,9-10,21H,2,7-8H2,1H3 |
| InChIKey | GFFHCYRWCWTXKR-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.13 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|