C21H13Cl2NO2S2 — CID 18806993
(5Z)-3-benzyl-5-[[5-(3,5-dichlorophenyl)furan-2-yl]methylidene]-4-sulfanylidene-1,3-thiazolidin-2-one (PubChem CID 18806993) has the molecular formula C21H13Cl2NO2S2 and a molecular weight of 446.38 g/mol. Its IUPAC name is (5Z)-3-benzyl-5-[[5-(3,5-dichlorophenyl)furan-2-yl]methylidene]-4-sulfanylidene-1,3-thiazolidin-2-one.
| Compound Name | (5Z)-3-benzyl-5-[[5-(3,5-dichlorophenyl)furan-2-yl]methylidene]-4-sulfanylidene-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 18806993 |
| Molecular Formula | C21H13Cl2NO2S2 |
| Molecular Weight | 446.38 g/mol |
| Exact Mass | 444.98 |
| IUPAC Name | (5Z)-3-benzyl-5-[[5-(3,5-dichlorophenyl)furan-2-yl]methylidene]-4-sulfanylidene-1,3-thiazolidin-2-one |
| SMILES | O=C1S/C(=C\c2ccc(-c3cc(Cl)cc(Cl)c3)o2)C(=S)N1Cc1ccccc1 |
| InChI | InChI=1S/C21H13Cl2NO2S2/c22-15-8-14(9-16(23)10-15)18-7-6-17(26-18)11-19-20(27)24(21(25)28-19)12-13-4-2-1-3-5-13/h1-11H,12H2/b19-11- |
| InChIKey | KXGQKBNUDFRGGM-ODLFYWEKSA-N |
| XLogP | 7.29 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.38 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_E(8)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|