C30H26BrNO5 — CID 18810665
7-bromo-1-(3-ethoxy-4-prop-2-enoxyphenyl)-2-[(4-methylphenyl)methyl]-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18810665) has the molecular formula C30H26BrNO5 and a molecular weight of 560.44 g/mol. Its IUPAC name is 7-bromo-1-(3-ethoxy-4-prop-2-enoxyphenyl)-2-[(4-methylphenyl)methyl]-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 7-bromo-1-(3-ethoxy-4-prop-2-enoxyphenyl)-2-[(4-methylphenyl)methyl]-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18810665 |
| Molecular Formula | C30H26BrNO5 |
| Molecular Weight | 560.44 g/mol |
| Exact Mass | 559.10 |
| IUPAC Name | 7-bromo-1-(3-ethoxy-4-prop-2-enoxyphenyl)-2-[(4-methylphenyl)methyl]-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | C=CCOc1ccc(C2c3c(oc4ccc(Br)cc4c3=O)C(=O)N2Cc2ccc(C)cc2)cc1OCC |
| InChI | InChI=1S/C30H26BrNO5/c1-4-14-36-24-12-10-20(15-25(24)35-5-2)27-26-28(33)22-16-21(31)11-13-23(22)37-29(26)30(34)32(27)17-19-8-6-18(3)7-9-19/h4,6-13,15-16,27H,1,5,14,17H2,2-3H3 |
| InChIKey | DWSCMKZPAZFRTH-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.44 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|