C26H26BrNO6 — CID 4706498
7-bromo-1-(3-ethoxy-4-prop-2-enoxyphenyl)-2-(3-methoxypropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 4706498) has the molecular formula C26H26BrNO6 and a molecular weight of 528.40 g/mol. Its IUPAC name is 7-bromo-1-(3-ethoxy-4-prop-2-enoxyphenyl)-2-(3-methoxypropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 7-bromo-1-(3-ethoxy-4-prop-2-enoxyphenyl)-2-(3-methoxypropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 4706498 |
| Molecular Formula | C26H26BrNO6 |
| Molecular Weight | 528.40 g/mol |
| Exact Mass | 527.09 |
| IUPAC Name | 7-bromo-1-(3-ethoxy-4-prop-2-enoxyphenyl)-2-(3-methoxypropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | C=CCOc1ccc(C2c3c(oc4ccc(Br)cc4c3=O)C(=O)N2CCCOC)cc1OCC |
| InChI | InChI=1S/C26H26BrNO6/c1-4-12-33-20-9-7-16(14-21(20)32-5-2)23-22-24(29)18-15-17(27)8-10-19(18)34-25(22)26(30)28(23)11-6-13-31-3/h4,7-10,14-15,23H,1,5-6,11-13H2,2-3H3 |
| InChIKey | CDUUYWCTOAKWCY-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 78.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.40 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|