C27H22BrNO6 — CID 18820358
7-bromo-1-(3-ethoxy-4-prop-2-enoxyphenyl)-2-(furan-2-ylmethyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18820358) has the molecular formula C27H22BrNO6 and a molecular weight of 536.38 g/mol. Its IUPAC name is 7-bromo-1-(3-ethoxy-4-prop-2-enoxyphenyl)-2-(furan-2-ylmethyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 7-bromo-1-(3-ethoxy-4-prop-2-enoxyphenyl)-2-(furan-2-ylmethyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18820358 |
| Molecular Formula | C27H22BrNO6 |
| Molecular Weight | 536.38 g/mol |
| Exact Mass | 535.06 |
| IUPAC Name | 7-bromo-1-(3-ethoxy-4-prop-2-enoxyphenyl)-2-(furan-2-ylmethyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | C=CCOc1ccc(C2c3c(oc4ccc(Br)cc4c3=O)C(=O)N2Cc2ccco2)cc1OCC |
| InChI | InChI=1S/C27H22BrNO6/c1-3-11-34-21-9-7-16(13-22(21)32-4-2)24-23-25(30)19-14-17(28)8-10-20(19)35-26(23)27(31)29(24)15-18-6-5-12-33-18/h3,5-10,12-14,24H,1,4,11,15H2,2H3 |
| InChIKey | CYALFUISWHKXTC-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 82.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.38 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|